C18H17N3O3S2 — CID 9086489
N'-(4-ethoxybenzoyl)-4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carbohydrazide (PubChem CID 9086489) has the molecular formula C18H17N3O3S2 and a molecular weight of 387.49 g/mol. Its IUPAC name is N'-(4-ethoxybenzoyl)-4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carbohydrazide.
| Compound Name | N'-(4-ethoxybenzoyl)-4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 9086489 |
| Molecular Formula | C18H17N3O3S2 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | N'-(4-ethoxybenzoyl)-4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carbohydrazide |
| SMILES | CCOc1ccc(C(=O)NNC(=O)c2sc(-c3ccsc3)nc2C)cc1 |
| InChI | InChI=1S/C18H17N3O3S2/c1-3-24-14-6-4-12(5-7-14)16(22)20-21-17(23)15-11(2)19-18(26-15)13-8-9-25-10-13/h4-10H,3H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | UPSAVQBMQZTKTF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|