C19H16BrN5O3S — CID 30376404
N'-(4-bromo-1-methylpyrrole-2-carbonyl)-2-(furan-2-yl)-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbohydrazide (PubChem CID 30376404) has the molecular formula C19H16BrN5O3S and a molecular weight of 474.34 g/mol. Its IUPAC name is N'-(4-bromo-1-methylpyrrole-2-carbonyl)-2-(furan-2-yl)-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbohydrazide.
| Compound Name | N'-(4-bromo-1-methylpyrrole-2-carbonyl)-2-(furan-2-yl)-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbohydrazide |
|---|---|
| PubChem CID | 30376404 |
| Molecular Formula | C19H16BrN5O3S |
| Molecular Weight | 474.34 g/mol |
| Exact Mass | 473.02 |
| IUPAC Name | N'-(4-bromo-1-methylpyrrole-2-carbonyl)-2-(furan-2-yl)-4,5-dimethylthieno[2,3-d]pyrimidine-6-carbohydrazide |
| SMILES | Cc1nc(-c2ccco2)nc2sc(C(=O)NNC(=O)c3cc(Br)cn3C)c(C)c12 |
| InChI | InChI=1S/C19H16BrN5O3S/c1-9-14-10(2)21-16(13-5-4-6-28-13)22-19(14)29-15(9)18(27)24-23-17(26)12-7-11(20)8-25(12)3/h4-8H,1-3H3,(H,23,26)(H,24,27) |
| InChIKey | PQCCQPKHIJMNDE-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 102.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|