C20H24N4O3S — CID 25472702
2-(furan-2-yl)-4,5-dimethyl-N-(3-morpholin-4-ylpropyl)thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 25472702) has the molecular formula C20H24N4O3S and a molecular weight of 400.50 g/mol. Its IUPAC name is 2-(furan-2-yl)-4,5-dimethyl-N-(3-morpholin-4-ylpropyl)thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 2-(furan-2-yl)-4,5-dimethyl-N-(3-morpholin-4-ylpropyl)thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 25472702 |
| Molecular Formula | C20H24N4O3S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 2-(furan-2-yl)-4,5-dimethyl-N-(3-morpholin-4-ylpropyl)thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1nc(-c2ccco2)nc2sc(C(=O)NCCCN3CCOCC3)c(C)c12 |
| InChI | InChI=1S/C20H24N4O3S/c1-13-16-14(2)22-18(15-5-3-10-27-15)23-20(16)28-17(13)19(25)21-6-4-7-24-8-11-26-12-9-24/h3,5,10H,4,6-9,11-12H2,1-2H3,(H,21,25) |
| InChIKey | QCMZXLKEPSEISI-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|