C19H21N5O2S — CID 134019539
N'-[3-(dimethylamino)benzoyl]-2,4,5-trimethylthieno[2,3-d]pyrimidine-6-carbohydrazide (PubChem CID 134019539) has the molecular formula C19H21N5O2S and a molecular weight of 383.48 g/mol. Its IUPAC name is N'-[3-(dimethylamino)benzoyl]-2,4,5-trimethylthieno[2,3-d]pyrimidine-6-carbohydrazide.
| Compound Name | N'-[3-(dimethylamino)benzoyl]-2,4,5-trimethylthieno[2,3-d]pyrimidine-6-carbohydrazide |
|---|---|
| PubChem CID | 134019539 |
| Molecular Formula | C19H21N5O2S |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | N'-[3-(dimethylamino)benzoyl]-2,4,5-trimethylthieno[2,3-d]pyrimidine-6-carbohydrazide |
| SMILES | Cc1nc(C)c2c(C)c(C(=O)NNC(=O)c3cccc(N(C)C)c3)sc2n1 |
| InChI | InChI=1S/C19H21N5O2S/c1-10-15-11(2)20-12(3)21-19(15)27-16(10)18(26)23-22-17(25)13-7-6-8-14(9-13)24(4)5/h6-9H,1-5H3,(H,22,25)(H,23,26) |
| InChIKey | JBVSCDDUBWZVGL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|