C14H17N5O2S — CID 37349014
N'-[3-(dimethylamino)benzoyl]-4-ethylthiadiazole-5-carbohydrazide (PubChem CID 37349014) has the molecular formula C14H17N5O2S and a molecular weight of 319.39 g/mol. Its IUPAC name is N'-[3-(dimethylamino)benzoyl]-4-ethylthiadiazole-5-carbohydrazide.
| Compound Name | N'-[3-(dimethylamino)benzoyl]-4-ethylthiadiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 37349014 |
| Molecular Formula | C14H17N5O2S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | N'-[3-(dimethylamino)benzoyl]-4-ethylthiadiazole-5-carbohydrazide |
| SMILES | CCc1nnsc1C(=O)NNC(=O)c1cccc(N(C)C)c1 |
| InChI | InChI=1S/C14H17N5O2S/c1-4-11-12(22-18-15-11)14(21)17-16-13(20)9-6-5-7-10(8-9)19(2)3/h5-8H,4H2,1-3H3,(H,16,20)(H,17,21) |
| InChIKey | OBBJEIBPDLCPFH-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|