C16H17N7O2 — CID 26184803
N'-[3-(dimethylamino)benzoyl]-7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbohydrazide (PubChem CID 26184803) has the molecular formula C16H17N7O2 and a molecular weight of 339.36 g/mol. Its IUPAC name is N'-[3-(dimethylamino)benzoyl]-7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbohydrazide.
| Compound Name | N'-[3-(dimethylamino)benzoyl]-7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbohydrazide |
|---|---|
| PubChem CID | 26184803 |
| Molecular Formula | C16H17N7O2 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | N'-[3-(dimethylamino)benzoyl]-7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbohydrazide |
| SMILES | Cc1ccnc2nc(C(=O)NNC(=O)c3cccc(N(C)C)c3)nn12 |
| InChI | InChI=1S/C16H17N7O2/c1-10-7-8-17-16-18-13(21-23(10)16)15(25)20-19-14(24)11-5-4-6-12(9-11)22(2)3/h4-9H,1-3H3,(H,19,24)(H,20,25) |
| InChIKey | IRYWZNWMDATTLO-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 104.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|