C13H9Cl3N6O — CID 26251367
7-methyl-N'-(2,4,6-trichlorophenyl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbohydrazide (PubChem CID 26251367) has the molecular formula C13H9Cl3N6O and a molecular weight of 371.62 g/mol. Its IUPAC name is 7-methyl-N'-(2,4,6-trichlorophenyl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbohydrazide.
| Compound Name | 7-methyl-N'-(2,4,6-trichlorophenyl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbohydrazide |
|---|---|
| PubChem CID | 26251367 |
| Molecular Formula | C13H9Cl3N6O |
| Molecular Weight | 371.62 g/mol |
| Exact Mass | 369.99 |
| IUPAC Name | 7-methyl-N'-(2,4,6-trichlorophenyl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbohydrazide |
| SMILES | Cc1ccnc2nc(C(=O)NNc3c(Cl)cc(Cl)cc3Cl)nn12 |
| InChI | InChI=1S/C13H9Cl3N6O/c1-6-2-3-17-13-18-11(21-22(6)13)12(23)20-19-10-8(15)4-7(14)5-9(10)16/h2-5,19H,1H3,(H,20,23) |
| InChIKey | DAWCQGYVWSHFBN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 84.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.62 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|