C14H11Cl3N6O — CID 34934019
5,7-dimethyl-N'-(2,4,6-trichlorophenyl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbohydrazide (PubChem CID 34934019) has the molecular formula C14H11Cl3N6O and a molecular weight of 385.64 g/mol. Its IUPAC name is 5,7-dimethyl-N'-(2,4,6-trichlorophenyl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbohydrazide.
| Compound Name | 5,7-dimethyl-N'-(2,4,6-trichlorophenyl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbohydrazide |
|---|---|
| PubChem CID | 34934019 |
| Molecular Formula | C14H11Cl3N6O |
| Molecular Weight | 385.64 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | 5,7-dimethyl-N'-(2,4,6-trichlorophenyl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbohydrazide |
| SMILES | Cc1cc(C)n2nc(C(=O)NNc3c(Cl)cc(Cl)cc3Cl)nc2n1 |
| InChI | InChI=1S/C14H11Cl3N6O/c1-6-3-7(2)23-14(18-6)19-12(22-23)13(24)21-20-11-9(16)4-8(15)5-10(11)17/h3-5,20H,1-2H3,(H,21,24) |
| InChIKey | JSRFBKQBAVSBCT-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 84.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.64 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|