C17H18N6O — CID 3299940
5,7-dimethyl-N'-[1-(4-methylphenyl)ethenyl]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbohydrazide (PubChem CID 3299940) has the molecular formula C17H18N6O and a molecular weight of 322.37 g/mol. Its IUPAC name is 5,7-dimethyl-N'-[1-(4-methylphenyl)ethenyl]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbohydrazide.
| Compound Name | 5,7-dimethyl-N'-[1-(4-methylphenyl)ethenyl]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbohydrazide |
|---|---|
| PubChem CID | 3299940 |
| Molecular Formula | C17H18N6O |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 5,7-dimethyl-N'-[1-(4-methylphenyl)ethenyl]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbohydrazide |
| SMILES | C=C(NNC(=O)c1nc2nc(C)cc(C)n2n1)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H18N6O/c1-10-5-7-14(8-6-10)13(4)20-21-16(24)15-19-17-18-11(2)9-12(3)23(17)22-15/h5-9,20H,4H2,1-3H3,(H,21,24) |
| InChIKey | OJFONSJJPQUABH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 84.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|