C20H19N7O2 — CID 130314162
1-benzyl-N-[(2S,4R,5R)-7-methyl-6-oxo-7,9,12-triazatricyclo[6.4.0.02,4]dodeca-1(12),8,10-trien-5-yl]triazole-4-carboxamide (PubChem CID 130314162) has the molecular formula C20H19N7O2 and a molecular weight of 389.42 g/mol. Its IUPAC name is 1-benzyl-N-[(2S,4R,5R)-7-methyl-6-oxo-7,9,12-triazatricyclo[6.4.0.02,4]dodeca-1(12),8,10-trien-5-yl]triazole-4-carboxamide.
| Compound Name | 1-benzyl-N-[(2S,4R,5R)-7-methyl-6-oxo-7,9,12-triazatricyclo[6.4.0.02,4]dodeca-1(12),8,10-trien-5-yl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 130314162 |
| Molecular Formula | C20H19N7O2 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 1-benzyl-N-[(2S,4R,5R)-7-methyl-6-oxo-7,9,12-triazatricyclo[6.4.0.02,4]dodeca-1(12),8,10-trien-5-yl]triazole-4-carboxamide |
| SMILES | CN1C(=O)[C@H](NC(=O)c2cn(Cc3ccccc3)nn2)[C@@H]2C[C@@H]2c2nccnc21 |
| InChI | InChI=1S/C20H19N7O2/c1-26-18-16(21-7-8-22-18)13-9-14(13)17(20(26)29)23-19(28)15-11-27(25-24-15)10-12-5-3-2-4-6-12/h2-8,11,13-14,17H,9-10H2,1H3,(H,23,28)/t13-,14+,17+/m0/s1 |
| InChIKey | NCGQIWSYAIAISY-JJRVBVJISA-N |
| XLogP | 0.99 |
| TPSA | 105.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |