C21H19F2N5O2 — CID 130317465
1-benzyl-N-[(3R,5S)-7,9-difluoro-5-methyl-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]triazole-4-carboxamide (PubChem CID 130317465) has the molecular formula C21H19F2N5O2 and a molecular weight of 411.41 g/mol. Its IUPAC name is 1-benzyl-N-[(3R,5S)-7,9-difluoro-5-methyl-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]triazole-4-carboxamide.
| Compound Name | 1-benzyl-N-[(3R,5S)-7,9-difluoro-5-methyl-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 130317465 |
| Molecular Formula | C21H19F2N5O2 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 1-benzyl-N-[(3R,5S)-7,9-difluoro-5-methyl-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]triazole-4-carboxamide |
| SMILES | C[C@H]1C[C@@H](NC(=O)c2cn(Cc3ccccc3)nn2)C(=O)Nc2c(F)cc(F)cc21 |
| InChI | InChI=1S/C21H19F2N5O2/c1-12-7-17(20(29)25-19-15(12)8-14(22)9-16(19)23)24-21(30)18-11-28(27-26-18)10-13-5-3-2-4-6-13/h2-6,8-9,11-12,17H,7,10H2,1H3,(H,24,30)(H,25,29)/t12-,17+/m0/s1 |
| InChIKey | MTHCELGWUCFSKC-YVEFUNNKSA-N |
| XLogP | 2.85 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |