C25H18F3N5O2 — CID 147001620
1-[(3-cyanophenyl)methyl]-N-[(3R,5S)-7,9-difluoro-2-oxo-5-prop-2-ynyl-1,3,4,5-tetrahydro-1-benzazepin-3-yl]-4-fluoropyrazole-3-carboxamide (PubChem CID 147001620) has the molecular formula C25H18F3N5O2 and a molecular weight of 477.45 g/mol. Its IUPAC name is 1-[(3-cyanophenyl)methyl]-N-[(3R,5S)-7,9-difluoro-2-oxo-5-prop-2-ynyl-1,3,4,5-tetrahydro-1-benzazepin-3-yl]-4-fluoropyrazole-3-carboxamide.
| Compound Name | 1-[(3-cyanophenyl)methyl]-N-[(3R,5S)-7,9-difluoro-2-oxo-5-prop-2-ynyl-1,3,4,5-tetrahydro-1-benzazepin-3-yl]-4-fluoropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 147001620 |
| Molecular Formula | C25H18F3N5O2 |
| Molecular Weight | 477.45 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | 1-[(3-cyanophenyl)methyl]-N-[(3R,5S)-7,9-difluoro-2-oxo-5-prop-2-ynyl-1,3,4,5-tetrahydro-1-benzazepin-3-yl]-4-fluoropyrazole-3-carboxamide |
| SMILES | C#CC[C@H]1C[C@@H](NC(=O)c2nn(Cc3cccc(C#N)c3)cc2F)C(=O)Nc2c(F)cc(F)cc21 |
| InChI | InChI=1S/C25H18F3N5O2/c1-2-4-16-8-21(24(34)31-22-18(16)9-17(26)10-19(22)27)30-25(35)23-20(28)13-33(32-23)12-15-6-3-5-14(7-15)11-29/h1,3,5-7,9-10,13,16,21H,4,8,12H2,(H,30,35)(H,31,34)/t16-,21+/m0/s1 |
| InChIKey | ASDGNCFZVAUOSF-HRAATJIYSA-N |
| XLogP | 3.47 |
| TPSA | 99.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|