C24H17F3N4O2 — CID 159022760
1-[(3-cyanophenyl)methyl]-N-[(2R,5S)-9,11-difluoro-6-oxo-5-tricyclo[6.4.0.02,4]dodeca-1(8),9,11-trienyl]-4-fluoropyrazole-3-carboxamide (PubChem CID 159022760) has the molecular formula C24H17F3N4O2 and a molecular weight of 450.42 g/mol. Its IUPAC name is 1-[(3-cyanophenyl)methyl]-N-[(2R,5S)-9,11-difluoro-6-oxo-5-tricyclo[6.4.0.02,4]dodeca-1(8),9,11-trienyl]-4-fluoropyrazole-3-carboxamide.
| Compound Name | 1-[(3-cyanophenyl)methyl]-N-[(2R,5S)-9,11-difluoro-6-oxo-5-tricyclo[6.4.0.02,4]dodeca-1(8),9,11-trienyl]-4-fluoropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 159022760 |
| Molecular Formula | C24H17F3N4O2 |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 1-[(3-cyanophenyl)methyl]-N-[(2R,5S)-9,11-difluoro-6-oxo-5-tricyclo[6.4.0.02,4]dodeca-1(8),9,11-trienyl]-4-fluoropyrazole-3-carboxamide |
| SMILES | N#Cc1cccc(Cn2cc(F)c(C(=O)N[C@@H]3C(=O)Cc4c(F)cc(F)cc4[C@@H]4CC34)n2)c1 |
| InChI | InChI=1S/C24H17F3N4O2/c25-14-5-15-16-7-18(16)22(21(32)8-17(15)19(26)6-14)29-24(33)23-20(27)11-31(30-23)10-13-3-1-2-12(4-13)9-28/h1-6,11,16,18,22H,7-8,10H2,(H,29,33)/t16-,18?,22-/m0/s1 |
| InChIKey | ZEQWVRGUJRXSOQ-QCQPBBGPSA-N |
| XLogP | 3.25 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |