C23H18F3N5O2 — CID 130317161
1-[(3-cyanophenyl)methyl]-N-[(3R,4R)-7,9-difluoro-4-methyl-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]-4-fluoropyrazole-3-carboxamide (PubChem CID 130317161) has the molecular formula C23H18F3N5O2 and a molecular weight of 453.42 g/mol. Its IUPAC name is 1-[(3-cyanophenyl)methyl]-N-[(3R,4R)-7,9-difluoro-4-methyl-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]-4-fluoropyrazole-3-carboxamide.
| Compound Name | 1-[(3-cyanophenyl)methyl]-N-[(3R,4R)-7,9-difluoro-4-methyl-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]-4-fluoropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 130317161 |
| Molecular Formula | C23H18F3N5O2 |
| Molecular Weight | 453.42 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | 1-[(3-cyanophenyl)methyl]-N-[(3R,4R)-7,9-difluoro-4-methyl-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]-4-fluoropyrazole-3-carboxamide |
| SMILES | C[C@@H]1Cc2cc(F)cc(F)c2NC(=O)[C@@H]1NC(=O)c1nn(Cc2cccc(C#N)c2)cc1F |
| InChI | InChI=1S/C23H18F3N5O2/c1-12-5-15-7-16(24)8-17(25)20(15)29-22(32)19(12)28-23(33)21-18(26)11-31(30-21)10-14-4-2-3-13(6-14)9-27/h2-4,6-8,11-12,19H,5,10H2,1H3,(H,28,33)(H,29,32)/t12-,19-/m1/s1 |
| InChIKey | BKHMXLBLDKBBMI-CWTRNNRKSA-N |
| XLogP | 3.15 |
| TPSA | 99.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |