C22H21FN6O3 — CID 155175332
3-[[3-[[[(2R,3S)-2,5-dimethyl-4-oxo-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl]amino]-hydroxymethyl]-4-fluoropyrazol-1-yl]methyl]benzonitrile (PubChem CID 155175332) has the molecular formula C22H21FN6O3 and a molecular weight of 436.45 g/mol. Its IUPAC name is 3-[[3-[[[(2R,3S)-2,5-dimethyl-4-oxo-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl]amino]-hydroxymethyl]-4-fluoropyrazol-1-yl]methyl]benzonitrile.
| Compound Name | 3-[[3-[[[(2R,3S)-2,5-dimethyl-4-oxo-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl]amino]-hydroxymethyl]-4-fluoropyrazol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 155175332 |
| Molecular Formula | C22H21FN6O3 |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 3-[[3-[[[(2R,3S)-2,5-dimethyl-4-oxo-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl]amino]-hydroxymethyl]-4-fluoropyrazol-1-yl]methyl]benzonitrile |
| SMILES | C[C@H]1Oc2cccnc2N(C)C(=O)[C@H]1NC(O)c1nn(Cc2cccc(C#N)c2)cc1F |
| InChI | InChI=1S/C22H21FN6O3/c1-13-18(22(31)28(2)20-17(32-13)7-4-8-25-20)26-21(30)19-16(23)12-29(27-19)11-15-6-3-5-14(9-15)10-24/h3-9,12-13,18,21,26,30H,11H2,1-2H3/t13-,18+,21?/m1/s1 |
| InChIKey | NUXZEOQKLOQSLZ-APMQKGJGSA-N |
| XLogP | 1.73 |
| TPSA | 116.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|