C21H21N7O3 — CID 134417456
(2Z)-2-[(3-cyanophenyl)methyl-methylhydrazinylidene]-2-(methylideneamino)-N-[(3S)-5-methyl-4-oxo-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl]acetamide (PubChem CID 134417456) has the molecular formula C21H21N7O3 and a molecular weight of 419.45 g/mol. Its IUPAC name is (2Z)-2-[(3-cyanophenyl)methyl-methylhydrazinylidene]-2-(methylideneamino)-N-[(3S)-5-methyl-4-oxo-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl]acetamide.
| Compound Name | (2Z)-2-[(3-cyanophenyl)methyl-methylhydrazinylidene]-2-(methylideneamino)-N-[(3S)-5-methyl-4-oxo-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl]acetamide |
|---|---|
| PubChem CID | 134417456 |
| Molecular Formula | C21H21N7O3 |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | (2Z)-2-[(3-cyanophenyl)methyl-methylhydrazinylidene]-2-(methylideneamino)-N-[(3S)-5-methyl-4-oxo-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl]acetamide |
| SMILES | C=N/C(=N\N(C)Cc1cccc(C#N)c1)C(=O)N[C@H]1COc2cccnc2N(C)C1=O |
| InChI | InChI=1S/C21H21N7O3/c1-23-18(26-27(2)12-15-7-4-6-14(10-15)11-22)20(29)25-16-13-31-17-8-5-9-24-19(17)28(3)21(16)30/h4-10,16H,1,12-13H2,2-3H3,(H,25,29)/b26-18-/t16-/m0/s1 |
| InChIKey | PHJDPQKWKCHPGZ-KAIAUPILSA-N |
| XLogP | 0.94 |
| TPSA | 123.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|