C20H19N3O3W2 — CID 162470235
CID 162470235 (PubChem CID 162470235) has the molecular formula C20H19N3O3W2 and a molecular weight of 717.07 g/mol.
| Compound Name | CID 162470235 |
|---|---|
| PubChem CID | 162470235 |
| Molecular Formula | C20H19N3O3W2 |
| Molecular Weight | 717.07 g/mol |
| Exact Mass | 717.04 |
| IUPAC Name | — |
| SMILES | CN1C(=O)C(NC(=O)C(=[W])CC(=[W])Cc2ccccc2)COc2cccnc21 |
| InChI | InChI=1S/C20H19N3O3.2W/c1-23-19-17(11-7-13-21-19)26-14-16(20(23)25)22-18(24)12-6-5-10-15-8-3-2-4-9-15;;/h2-4,7-9,11,13,16H,6,10,14H2,1H3,(H,22,24);; |
| InChIKey | HOVCGLMQHHTEAT-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.07 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |