C20H22N4O3 — CID 176882642
N'-(9-methyl-8-oxo-6,7-dihydro-5H-pyrido[2,3-b]azepin-7-yl)-N-(2-phenylethyl)oxamide (PubChem CID 176882642) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is N'-(9-methyl-8-oxo-6,7-dihydro-5H-pyrido[2,3-b]azepin-7-yl)-N-(2-phenylethyl)oxamide.
| Compound Name | N'-(9-methyl-8-oxo-6,7-dihydro-5H-pyrido[2,3-b]azepin-7-yl)-N-(2-phenylethyl)oxamide |
|---|---|
| PubChem CID | 176882642 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | N'-(9-methyl-8-oxo-6,7-dihydro-5H-pyrido[2,3-b]azepin-7-yl)-N-(2-phenylethyl)oxamide |
| SMILES | CN1C(=O)C(NC(=O)C(=O)NCCc2ccccc2)CCc2cccnc21 |
| InChI | InChI=1S/C20H22N4O3/c1-24-17-15(8-5-12-21-17)9-10-16(20(24)27)23-19(26)18(25)22-13-11-14-6-3-2-4-7-14/h2-8,12,16H,9-11,13H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | VXJSJJTZFYVFTO-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|