C22H21N3O2W — CID 168852263
[1-[(1-methyl-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl)amino]-1-oxo-5-phenylpent-3-en-2-ylidene]azanide;tungsten(2+) (PubChem CID 168852263) has the molecular formula C22H21N3O2W and a molecular weight of 543.27 g/mol. Its IUPAC name is [1-[(1-methyl-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl)amino]-1-oxo-5-phenylpent-3-en-2-ylidene]azanide;tungsten(2+).
| Compound Name | [1-[(1-methyl-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl)amino]-1-oxo-5-phenylpent-3-en-2-ylidene]azanide;tungsten(2+) |
|---|---|
| PubChem CID | 168852263 |
| Molecular Formula | C22H21N3O2W |
| Molecular Weight | 543.27 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | [1-[(1-methyl-2-oxo-4,5-dihydro-3H-1-benzazepin-3-yl)amino]-1-oxo-5-phenylpent-3-en-2-ylidene]azanide;tungsten(2+) |
| SMILES | CN1C(=O)C(NC(=O)C(=[N-])/C=[C-]/Cc2ccccc2)CCc2ccccc21.[W+2] |
| InChI | InChI=1S/C22H21N3O2.W/c1-25-20-13-6-5-11-17(20)14-15-19(22(25)27)24-21(26)18(23)12-7-10-16-8-3-2-4-9-16;/h2-6,8-9,11-13,19H,10,14-15H2,1H3,(H,24,26);/q-2;+2 |
| InChIKey | VHYLJVSJILTCQR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 71.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.27 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|