C20H20N6O2S — CID 164835670
1-[(2-methylphenyl)methyl]-N-(5-methyl-4-sulfanylidene-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl)-1,2,4-triazole-3-carboxamide (PubChem CID 164835670) has the molecular formula C20H20N6O2S and a molecular weight of 408.49 g/mol. Its IUPAC name is 1-[(2-methylphenyl)methyl]-N-(5-methyl-4-sulfanylidene-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl)-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-[(2-methylphenyl)methyl]-N-(5-methyl-4-sulfanylidene-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 164835670 |
| Molecular Formula | C20H20N6O2S |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 1-[(2-methylphenyl)methyl]-N-(5-methyl-4-sulfanylidene-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl)-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1ccccc1Cn1cnc(C(=O)NC2COc3cccnc3N(C)C2=S)n1 |
| InChI | InChI=1S/C20H20N6O2S/c1-13-6-3-4-7-14(13)10-26-12-22-17(24-26)19(27)23-15-11-28-16-8-5-9-21-18(16)25(2)20(15)29/h3-9,12,15H,10-11H2,1-2H3,(H,23,27) |
| InChIKey | ZHCDXTXAYAECSJ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|