C20H17F3N6O2S — CID 155357263
N-(5-methyl-4-sulfanylidene-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl)-1-[[4-(trifluoromethyl)phenyl]methyl]-1,2,4-triazole-3-carboxamide (PubChem CID 155357263) has the molecular formula C20H17F3N6O2S and a molecular weight of 462.46 g/mol. Its IUPAC name is N-(5-methyl-4-sulfanylidene-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl)-1-[[4-(trifluoromethyl)phenyl]methyl]-1,2,4-triazole-3-carboxamide.
| Compound Name | N-(5-methyl-4-sulfanylidene-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl)-1-[[4-(trifluoromethyl)phenyl]methyl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 155357263 |
| Molecular Formula | C20H17F3N6O2S |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | N-(5-methyl-4-sulfanylidene-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl)-1-[[4-(trifluoromethyl)phenyl]methyl]-1,2,4-triazole-3-carboxamide |
| SMILES | CN1C(=S)C(NC(=O)c2ncn(Cc3ccc(C(F)(F)F)cc3)n2)COc2cccnc21 |
| InChI | InChI=1S/C20H17F3N6O2S/c1-28-17-15(3-2-8-24-17)31-10-14(19(28)32)26-18(30)16-25-11-29(27-16)9-12-4-6-13(7-5-12)20(21,22)23/h2-8,11,14H,9-10H2,1H3,(H,26,30) |
| InChIKey | WRFPXZOIJYBNAJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|