C24H16F3N5O2 — CID 130340588
1-[(3-cyanophenyl)methyl]-N-[(3R,4S)-4-ethynyl-7,9-difluoro-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]-4-fluoropyrazole-3-carboxamide (PubChem CID 130340588) has the molecular formula C24H16F3N5O2 and a molecular weight of 463.42 g/mol. Its IUPAC name is 1-[(3-cyanophenyl)methyl]-N-[(3R,4S)-4-ethynyl-7,9-difluoro-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]-4-fluoropyrazole-3-carboxamide.
| Compound Name | 1-[(3-cyanophenyl)methyl]-N-[(3R,4S)-4-ethynyl-7,9-difluoro-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]-4-fluoropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 130340588 |
| Molecular Formula | C24H16F3N5O2 |
| Molecular Weight | 463.42 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | 1-[(3-cyanophenyl)methyl]-N-[(3R,4S)-4-ethynyl-7,9-difluoro-2-oxo-1,3,4,5-tetrahydro-1-benzazepin-3-yl]-4-fluoropyrazole-3-carboxamide |
| SMILES | C#C[C@@H]1Cc2cc(F)cc(F)c2NC(=O)[C@@H]1NC(=O)c1nn(Cc2cccc(C#N)c2)cc1F |
| InChI | InChI=1S/C24H16F3N5O2/c1-2-15-7-16-8-17(25)9-18(26)20(16)29-23(33)21(15)30-24(34)22-19(27)12-32(31-22)11-14-5-3-4-13(6-14)10-28/h1,3-6,8-9,12,15,21H,7,11H2,(H,29,33)(H,30,34)/t15-,21-/m1/s1 |
| InChIKey | HDTDWTABAMWMTN-QVKFZJNVSA-N |
| XLogP | 2.76 |
| TPSA | 99.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|