C15H13ClN2O2 — CID 103816930
6-chloro-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]pyridine-2-carboxamide (PubChem CID 103816930) has the molecular formula C15H13ClN2O2 and a molecular weight of 288.73 g/mol. Its IUPAC name is 6-chloro-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]pyridine-2-carboxamide.
| Compound Name | 6-chloro-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 103816930 |
| Molecular Formula | C15H13ClN2O2 |
| Molecular Weight | 288.73 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 6-chloro-N-[(1R,2S)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]pyridine-2-carboxamide |
| SMILES | O=C(N[C@@H]1c2ccccc2C[C@@H]1O)c1cccc(Cl)n1 |
| InChI | InChI=1S/C15H13ClN2O2/c16-13-7-3-6-11(17-13)15(20)18-14-10-5-2-1-4-9(10)8-12(14)19/h1-7,12,14,19H,8H2,(H,18,20)/t12-,14+/m0/s1 |
| InChIKey | XFUGMTGTPIFOCR-GXTWGEPZSA-N |
| XLogP | 2.12 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.73 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|