C17H22N2O2 — CID 103707614
N-(3-ethoxy-2,2-dimethylcyclobutyl)-1H-indole-7-carboxamide (PubChem CID 103707614) has the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. Its IUPAC name is N-(3-ethoxy-2,2-dimethylcyclobutyl)-1H-indole-7-carboxamide.
| Compound Name | N-(3-ethoxy-2,2-dimethylcyclobutyl)-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 103707614 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | N-(3-ethoxy-2,2-dimethylcyclobutyl)-1H-indole-7-carboxamide |
| SMILES | CCOC1CC(NC(=O)c2cccc3cc[nH]c23)C1(C)C |
| InChI | InChI=1S/C17H22N2O2/c1-4-21-14-10-13(17(14,2)3)19-16(20)12-7-5-6-11-8-9-18-15(11)12/h5-9,13-14,18H,4,10H2,1-3H3,(H,19,20) |
| InChIKey | FYUVQPZOXMXIIS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |