C15H19N3O — CID 102724878
N-[(1R,2R)-2-aminocyclohexyl]-1H-indole-7-carboxamide (PubChem CID 102724878) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is N-[(1R,2R)-2-aminocyclohexyl]-1H-indole-7-carboxamide.
| Compound Name | N-[(1R,2R)-2-aminocyclohexyl]-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 102724878 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | N-[(1R,2R)-2-aminocyclohexyl]-1H-indole-7-carboxamide |
| SMILES | N[C@@H]1CCCC[C@H]1NC(=O)c1cccc2cc[nH]c12 |
| InChI | InChI=1S/C15H19N3O/c16-12-6-1-2-7-13(12)18-15(19)11-5-3-4-10-8-9-17-14(10)11/h3-5,8-9,12-13,17H,1-2,6-7,16H2,(H,18,19)/t12-,13-/m1/s1 |
| InChIKey | ULTOPADYXSTJRL-CHWSQXEVSA-N |
| XLogP | 2.17 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |