C13H16BrFN2O — CID 114020422
N-[(1R,2R)-2-aminocyclohexyl]-3-bromo-2-fluorobenzamide (PubChem CID 114020422) has the molecular formula C13H16BrFN2O and a molecular weight of 315.19 g/mol. Its IUPAC name is N-[(1R,2R)-2-aminocyclohexyl]-3-bromo-2-fluorobenzamide.
| Compound Name | N-[(1R,2R)-2-aminocyclohexyl]-3-bromo-2-fluorobenzamide |
|---|---|
| PubChem CID | 114020422 |
| Molecular Formula | C13H16BrFN2O |
| Molecular Weight | 315.19 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | N-[(1R,2R)-2-aminocyclohexyl]-3-bromo-2-fluorobenzamide |
| SMILES | N[C@@H]1CCCC[C@H]1NC(=O)c1cccc(Br)c1F |
| InChI | InChI=1S/C13H16BrFN2O/c14-9-5-3-4-8(12(9)15)13(18)17-11-7-2-1-6-10(11)16/h3-5,10-11H,1-2,6-7,16H2,(H,17,18)/t10-,11-/m1/s1 |
| InChIKey | YVNGESJUSGIABS-GHMZBOCLSA-N |
| XLogP | 2.59 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.19 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |