C14H18INO2 — CID 113252946
2-iodo-N-(3-methoxy-2,2-dimethylcyclobutyl)benzamide (PubChem CID 113252946) has the molecular formula C14H18INO2 and a molecular weight of 359.21 g/mol. Its IUPAC name is 2-iodo-N-(3-methoxy-2,2-dimethylcyclobutyl)benzamide.
| Compound Name | 2-iodo-N-(3-methoxy-2,2-dimethylcyclobutyl)benzamide |
|---|---|
| PubChem CID | 113252946 |
| Molecular Formula | C14H18INO2 |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | 2-iodo-N-(3-methoxy-2,2-dimethylcyclobutyl)benzamide |
| SMILES | COC1CC(NC(=O)c2ccccc2I)C1(C)C |
| InChI | InChI=1S/C14H18INO2/c1-14(2)11(8-12(14)18-3)16-13(17)9-6-4-5-7-10(9)15/h4-7,11-12H,8H2,1-3H3,(H,16,17) |
| InChIKey | QZIBNMMLSILECV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|