C13H17BrN2O2 — CID 113255805
2-bromo-N-(3-methoxy-2,2-dimethylcyclobutyl)pyridine-3-carboxamide (PubChem CID 113255805) has the molecular formula C13H17BrN2O2 and a molecular weight of 313.19 g/mol. Its IUPAC name is 2-bromo-N-(3-methoxy-2,2-dimethylcyclobutyl)pyridine-3-carboxamide.
| Compound Name | 2-bromo-N-(3-methoxy-2,2-dimethylcyclobutyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 113255805 |
| Molecular Formula | C13H17BrN2O2 |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 2-bromo-N-(3-methoxy-2,2-dimethylcyclobutyl)pyridine-3-carboxamide |
| SMILES | COC1CC(NC(=O)c2cccnc2Br)C1(C)C |
| InChI | InChI=1S/C13H17BrN2O2/c1-13(2)9(7-10(13)18-3)16-12(17)8-5-4-6-15-11(8)14/h4-6,9-10H,7H2,1-3H3,(H,16,17) |
| InChIKey | AGZDKFIABMLSII-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|