C21H28N4O3 — CID 119146327
3-N-(3-ethoxy-2,2-diethylcyclobutyl)-1-phenylpyrazole-3,5-dicarboxamide (PubChem CID 119146327) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is 3-N-(3-ethoxy-2,2-diethylcyclobutyl)-1-phenylpyrazole-3,5-dicarboxamide.
| Compound Name | 3-N-(3-ethoxy-2,2-diethylcyclobutyl)-1-phenylpyrazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 119146327 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | 3-N-(3-ethoxy-2,2-diethylcyclobutyl)-1-phenylpyrazole-3,5-dicarboxamide |
| SMILES | CCOC1CC(NC(=O)c2cc(C(N)=O)n(-c3ccccc3)n2)C1(CC)CC |
| InChI | InChI=1S/C21H28N4O3/c1-4-21(5-2)17(13-18(21)28-6-3)23-20(27)15-12-16(19(22)26)25(24-15)14-10-8-7-9-11-14/h7-12,17-18H,4-6,13H2,1-3H3,(H2,22,26)(H,23,27) |
| InChIKey | DQSDNQHVWFOCAP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |