About 1-phenyl-3-N-(4-phenylcyclohexyl)pyrazole-3,5-dicarboxamide
1-phenyl-3-N-(4-phenylcyclohexyl)pyrazole-3,5-dicarboxamide (PubChem CID 119128221) has the molecular formula C23H24N4O2
and a molecular weight of 388.47 g/mol. Its IUPAC name is 1-phenyl-3-N-(4-phenylcyclohexyl)pyrazole-3,5-dicarboxamide.
Molecular Properties
| Compound Name | 1-phenyl-3-N-(4-phenylcyclohexyl)pyrazole-3,5-dicarboxamide |
| PubChem CID | 119128221 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 1-phenyl-3-N-(4-phenylcyclohexyl)pyrazole-3,5-dicarboxamide |
| SMILES | NC(=O)c1cc(C(=O)NC2CCC(c3ccccc3)CC2)nn1-c1ccccc1 |
| InChI | InChI=1S/C23H24N4O2/c24-22(28)21-15-20(26-27(21)19-9-5-2-6-10-19)23(29)25-18-13-11-17(12-14-18)16-7-3-1-4-8-16/h1-10,15,17-18H,11-14H2,(H2,24,28)(H,25,29) |
| InChIKey | LPXOFAKXTGONDY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-phenyl-3-N-(4-phenylcyclohexyl)pyrazole-3,5-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-3-N-(4-phenylcyclohexyl)pyrazole-3,5-dicarboxamide?
The IUPAC name of 1-phenyl-3-N-(4-phenylcyclohexyl)pyrazole-3,5-dicarboxamide (CID 119128221) is 1-phenyl-3-N-(4-phenylcyclohexyl)pyrazole-3,5-dicarboxamide.
What is the SMILES notation for 1-phenyl-3-N-(4-phenylcyclohexyl)pyrazole-3,5-dicarboxamide?
The canonical SMILES for 1-phenyl-3-N-(4-phenylcyclohexyl)pyrazole-3,5-dicarboxamide is NC(=O)c1cc(C(=O)NC2CCC(c3ccccc3)CC2)nn1-c1ccccc1.
What is the InChIKey of 1-phenyl-3-N-(4-phenylcyclohexyl)pyrazole-3,5-dicarboxamide?
The InChIKey is LPXOFAKXTGONDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24N4O2/c24-22(28)21-15-20(26-27(21)19-9-5-2-6-10-19)23(29)25-18-13-11-17(12-14-18)16-7-3-1-4-8-16/h1-10,15,17-18H,11-14H2,(H2,24,28)(H,25,29).
What are the key properties of 1-phenyl-3-N-(4-phenylcyclohexyl)pyrazole-3,5-dicarboxamide?
1-phenyl-3-N-(4-phenylcyclohexyl)pyrazole-3,5-dicarboxamide has a molecular weight of 388.47 g/mol, XLogP of 3.43, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-3-N-(4-phenylcyclohexyl)pyrazole-3,5-dicarboxamide is sourced from PubChem (CID 119128221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).