C20H25N3O — CID 9462634
3-cyclopropyl-N-(4-methylcyclohexyl)-1-phenylpyrazole-5-carboxamide (PubChem CID 9462634) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is 3-cyclopropyl-N-(4-methylcyclohexyl)-1-phenylpyrazole-5-carboxamide.
| Compound Name | 3-cyclopropyl-N-(4-methylcyclohexyl)-1-phenylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 9462634 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 3-cyclopropyl-N-(4-methylcyclohexyl)-1-phenylpyrazole-5-carboxamide |
| SMILES | CC1CCC(NC(=O)c2cc(C3CC3)nn2-c2ccccc2)CC1 |
| InChI | InChI=1S/C20H25N3O/c1-14-7-11-16(12-8-14)21-20(24)19-13-18(15-9-10-15)22-23(19)17-5-3-2-4-6-17/h2-6,13-16H,7-12H2,1H3,(H,21,24) |
| InChIKey | HGZZUBXPCNHMRH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |