C20H25N3O — CID 43024528
3-cyclopropyl-N-(2-methylcyclohexyl)-1-phenylpyrazole-5-carboxamide (PubChem CID 43024528) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is 3-cyclopropyl-N-(2-methylcyclohexyl)-1-phenylpyrazole-5-carboxamide.
| Compound Name | 3-cyclopropyl-N-(2-methylcyclohexyl)-1-phenylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 43024528 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 3-cyclopropyl-N-(2-methylcyclohexyl)-1-phenylpyrazole-5-carboxamide |
| SMILES | CC1CCCCC1NC(=O)c1cc(C2CC2)nn1-c1ccccc1 |
| InChI | InChI=1S/C20H25N3O/c1-14-7-5-6-10-17(14)21-20(24)19-13-18(15-11-12-15)22-23(19)16-8-3-2-4-9-16/h2-4,8-9,13-15,17H,5-7,10-12H2,1H3,(H,21,24) |
| InChIKey | YELUAJILCMRAMZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |