C22H23N3O2 — CID 2107436
N-[(1R,2R)-2-methylcyclohexyl]-4-oxo-3-phenylphthalazine-1-carboxamide (PubChem CID 2107436) has the molecular formula C22H23N3O2 and a molecular weight of 361.44 g/mol. Its IUPAC name is N-[(1R,2R)-2-methylcyclohexyl]-4-oxo-3-phenylphthalazine-1-carboxamide.
| Compound Name | N-[(1R,2R)-2-methylcyclohexyl]-4-oxo-3-phenylphthalazine-1-carboxamide |
|---|---|
| PubChem CID | 2107436 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | N-[(1R,2R)-2-methylcyclohexyl]-4-oxo-3-phenylphthalazine-1-carboxamide |
| SMILES | C[C@@H]1CCCC[C@H]1NC(=O)c1nn(-c2ccccc2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C22H23N3O2/c1-15-9-5-8-14-19(15)23-21(26)20-17-12-6-7-13-18(17)22(27)25(24-20)16-10-3-2-4-11-16/h2-4,6-7,10-13,15,19H,5,8-9,14H2,1H3,(H,23,26)/t15-,19-/m1/s1 |
| InChIKey | ZKEPORVIFDOTNR-DNVCBOLYSA-N |
| XLogP | 3.69 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |