About ethyl 4-[[N'-(3-ethoxy-2,2-diethylcyclobutyl)carbamimidoyl]amino]piperidine-1-carboxylate
ethyl 4-[[N'-(3-ethoxy-2,2-diethylcyclobutyl)carbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111824147) has the molecular formula C19H36N4O3
and a molecular weight of 368.52 g/mol. Its IUPAC name is ethyl 4-[[N'-(3-ethoxy-2,2-diethylcyclobutyl)carbamimidoyl]amino]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[[N'-(3-ethoxy-2,2-diethylcyclobutyl)carbamimidoyl]amino]piperidine-1-carboxylate |
| PubChem CID | 111824147 |
| Molecular Formula | C19H36N4O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.28 |
| IUPAC Name | ethyl 4-[[N'-(3-ethoxy-2,2-diethylcyclobutyl)carbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N/C(N)=N/C2CC(OCC)C2(CC)CC)CC1 |
| InChI | InChI=1S/C19H36N4O3/c1-5-19(6-2)15(13-16(19)25-7-3)22-17(20)21-14-9-11-23(12-10-14)18(24)26-8-4/h14-16H,5-13H2,1-4H3,(H3,20,21,22) |
| InChIKey | QRVHFWIQUHVHHV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[[N'-(3-ethoxy-2,2-diethylcyclobutyl)carbamimidoyl]amino]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[[N'-(3-ethoxy-2,2-diethylcyclobutyl)carbamimidoyl]amino]piperidine-1-carboxylate?
The IUPAC name of ethyl 4-[[N'-(3-ethoxy-2,2-diethylcyclobutyl)carbamimidoyl]amino]piperidine-1-carboxylate (CID 111824147) is ethyl 4-[[N'-(3-ethoxy-2,2-diethylcyclobutyl)carbamimidoyl]amino]piperidine-1-carboxylate.
What is the SMILES notation for ethyl 4-[[N'-(3-ethoxy-2,2-diethylcyclobutyl)carbamimidoyl]amino]piperidine-1-carboxylate?
The canonical SMILES for ethyl 4-[[N'-(3-ethoxy-2,2-diethylcyclobutyl)carbamimidoyl]amino]piperidine-1-carboxylate is CCOC(=O)N1CCC(N/C(N)=N/C2CC(OCC)C2(CC)CC)CC1.
What is the InChIKey of ethyl 4-[[N'-(3-ethoxy-2,2-diethylcyclobutyl)carbamimidoyl]amino]piperidine-1-carboxylate?
The InChIKey is QRVHFWIQUHVHHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36N4O3/c1-5-19(6-2)15(13-16(19)25-7-3)22-17(20)21-14-9-11-23(12-10-14)18(24)26-8-4/h14-16H,5-13H2,1-4H3,(H3,20,21,22).
What are the key properties of ethyl 4-[[N'-(3-ethoxy-2,2-diethylcyclobutyl)carbamimidoyl]amino]piperidine-1-carboxylate?
ethyl 4-[[N'-(3-ethoxy-2,2-diethylcyclobutyl)carbamimidoyl]amino]piperidine-1-carboxylate has a molecular weight of 368.52 g/mol, XLogP of 2.50, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[[N'-(3-ethoxy-2,2-diethylcyclobutyl)carbamimidoyl]amino]piperidine-1-carboxylate is sourced from PubChem (CID 111824147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).