C10H20O2 — CID 64569995
3-ethoxy-2,2-diethylcyclobutan-1-ol (PubChem CID 64569995) has the molecular formula C10H20O2 and a molecular weight of 172.27 g/mol. Its IUPAC name is 3-ethoxy-2,2-diethylcyclobutan-1-ol.
| Compound Name | 3-ethoxy-2,2-diethylcyclobutan-1-ol |
|---|---|
| PubChem CID | 64569995 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | 3-ethoxy-2,2-diethylcyclobutan-1-ol |
| SMILES | CCOC1CC(O)C1(CC)CC |
| InChI | InChI=1S/C10H20O2/c1-4-10(5-2)8(11)7-9(10)12-6-3/h8-9,11H,4-7H2,1-3H3 |
| InChIKey | QUIVUPNCGPWRPN-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |