C8H16O2 — CID 95240890
cis-(1S,3R)-3-ethoxy-2,2-dimethylcyclobutan-1-ol (PubChem CID 95240890) has the molecular formula C8H16O2 and a molecular weight of 144.21 g/mol. Its IUPAC name is cis-(1S,3R)-3-ethoxy-2,2-dimethylcyclobutan-1-ol.
| Compound Name | cis-(1S,3R)-3-ethoxy-2,2-dimethylcyclobutan-1-ol |
|---|---|
| PubChem CID | 95240890 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | cis-(1S,3R)-3-ethoxy-2,2-dimethylcyclobutan-1-ol |
| SMILES | CCO[C@@H]1C[C@H](O)C1(C)C |
| InChI | InChI=1S/C8H16O2/c1-4-10-7-5-6(9)8(7,2)3/h6-7,9H,4-5H2,1-3H3/t6-,7+/m0/s1 |
| InChIKey | SNZVOCZNCMCBKA-NKWVEPMBSA-N |
| XLogP | 1.18 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |