C10H18O3 — CID 97300110
(1R,3R)-3-ethoxy-7-oxaspiro[3.5]nonan-1-ol (PubChem CID 97300110) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is (1R,3R)-3-ethoxy-7-oxaspiro[3.5]nonan-1-ol.
| Compound Name | (1R,3R)-3-ethoxy-7-oxaspiro[3.5]nonan-1-ol |
|---|---|
| PubChem CID | 97300110 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (1R,3R)-3-ethoxy-7-oxaspiro[3.5]nonan-1-ol |
| SMILES | CCO[C@@H]1C[C@@H](O)C12CCOCC2 |
| InChI | InChI=1S/C10H18O3/c1-2-13-9-7-8(11)10(9)3-5-12-6-4-10/h8-9,11H,2-7H2,1H3/t8-,9-/m1/s1 |
| InChIKey | CHKDSMZFHOZVDI-RKDXNWHRSA-N |
| XLogP | 0.95 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |