C15H27NO3 — CID 111456794
1-(3-ethoxy-1-hydroxy-7-azaspiro[3.5]nonan-7-yl)-2-methylbutan-1-one (PubChem CID 111456794) has the molecular formula C15H27NO3 and a molecular weight of 269.38 g/mol. Its IUPAC name is 1-(3-ethoxy-1-hydroxy-7-azaspiro[3.5]nonan-7-yl)-2-methylbutan-1-one.
| Compound Name | 1-(3-ethoxy-1-hydroxy-7-azaspiro[3.5]nonan-7-yl)-2-methylbutan-1-one |
|---|---|
| PubChem CID | 111456794 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | 1-(3-ethoxy-1-hydroxy-7-azaspiro[3.5]nonan-7-yl)-2-methylbutan-1-one |
| SMILES | CCOC1CC(O)C12CCN(C(=O)C(C)CC)CC2 |
| InChI | InChI=1S/C15H27NO3/c1-4-11(3)14(18)16-8-6-15(7-9-16)12(17)10-13(15)19-5-2/h11-13,17H,4-10H2,1-3H3 |
| InChIKey | OZSNCJIQPMSESD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |