C15H29ClN2O4 — CID 119801192
1-(3-ethoxy-1-hydroxy-7-azaspiro[3.5]nonan-7-yl)-2-(2-methoxyethylamino)ethanone;hydrochloride (PubChem CID 119801192) has the molecular formula C15H29ClN2O4 and a molecular weight of 336.86 g/mol. Its IUPAC name is 1-(3-ethoxy-1-hydroxy-7-azaspiro[3.5]nonan-7-yl)-2-(2-methoxyethylamino)ethanone;hydrochloride.
| Compound Name | 1-(3-ethoxy-1-hydroxy-7-azaspiro[3.5]nonan-7-yl)-2-(2-methoxyethylamino)ethanone;hydrochloride |
|---|---|
| PubChem CID | 119801192 |
| Molecular Formula | C15H29ClN2O4 |
| Molecular Weight | 336.86 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 1-(3-ethoxy-1-hydroxy-7-azaspiro[3.5]nonan-7-yl)-2-(2-methoxyethylamino)ethanone;hydrochloride |
| SMILES | CCOC1CC(O)C12CCN(C(=O)CNCCOC)CC2.Cl |
| InChI | InChI=1S/C15H28N2O4.ClH/c1-3-21-13-10-12(18)15(13)4-7-17(8-5-15)14(19)11-16-6-9-20-2;/h12-13,16,18H,3-11H2,1-2H3;1H |
| InChIKey | YULZFMUONPIHNZ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.86 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|