C13H29Cl2N3O2 — CID 119831605
2-(2-methoxyethylamino)-1-[4-(2-methylpropyl)piperazin-1-yl]ethanone;dihydrochloride (PubChem CID 119831605) has the molecular formula C13H29Cl2N3O2 and a molecular weight of 330.30 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-1-[4-(2-methylpropyl)piperazin-1-yl]ethanone;dihydrochloride.
| Compound Name | 2-(2-methoxyethylamino)-1-[4-(2-methylpropyl)piperazin-1-yl]ethanone;dihydrochloride |
|---|---|
| PubChem CID | 119831605 |
| Molecular Formula | C13H29Cl2N3O2 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 2-(2-methoxyethylamino)-1-[4-(2-methylpropyl)piperazin-1-yl]ethanone;dihydrochloride |
| SMILES | COCCNCC(=O)N1CCN(CC(C)C)CC1.Cl.Cl |
| InChI | InChI=1S/C13H27N3O2.2ClH/c1-12(2)11-15-5-7-16(8-6-15)13(17)10-14-4-9-18-3;;/h12,14H,4-11H2,1-3H3;2*1H |
| InChIKey | KFHPTMSCAIARBW-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|