C11H23N3O2 — CID 79281462
2-(2-methoxyethylamino)-1-(4-methyl-1,4-diazepan-1-yl)ethanone (PubChem CID 79281462) has the molecular formula C11H23N3O2 and a molecular weight of 229.32 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-1-(4-methyl-1,4-diazepan-1-yl)ethanone.
| Compound Name | 2-(2-methoxyethylamino)-1-(4-methyl-1,4-diazepan-1-yl)ethanone |
|---|---|
| PubChem CID | 79281462 |
| Molecular Formula | C11H23N3O2 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 2-(2-methoxyethylamino)-1-(4-methyl-1,4-diazepan-1-yl)ethanone |
| SMILES | COCCNCC(=O)N1CCCN(C)CC1 |
| InChI | InChI=1S/C11H23N3O2/c1-13-5-3-6-14(8-7-13)11(15)10-12-4-9-16-2/h12H,3-10H2,1-2H3 |
| InChIKey | RJKXDNBKZYQZMR-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|