C12H25ClN2O2 — CID 119734708
1-(3,3-dimethylpiperidin-1-yl)-2-(2-methoxyethylamino)ethanone;hydrochloride (PubChem CID 119734708) has the molecular formula C12H25ClN2O2 and a molecular weight of 264.80 g/mol. Its IUPAC name is 1-(3,3-dimethylpiperidin-1-yl)-2-(2-methoxyethylamino)ethanone;hydrochloride.
| Compound Name | 1-(3,3-dimethylpiperidin-1-yl)-2-(2-methoxyethylamino)ethanone;hydrochloride |
|---|---|
| PubChem CID | 119734708 |
| Molecular Formula | C12H25ClN2O2 |
| Molecular Weight | 264.80 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 1-(3,3-dimethylpiperidin-1-yl)-2-(2-methoxyethylamino)ethanone;hydrochloride |
| SMILES | COCCNCC(=O)N1CCCC(C)(C)C1.Cl |
| InChI | InChI=1S/C12H24N2O2.ClH/c1-12(2)5-4-7-14(10-12)11(15)9-13-6-8-16-3;/h13H,4-10H2,1-3H3;1H |
| InChIKey | SWXPNDOUBXCHOH-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.80 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|