C11H22N2O3 — CID 79282191
1-(2,2-dimethylmorpholin-4-yl)-2-(2-methoxyethylamino)ethanone (PubChem CID 79282191) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is 1-(2,2-dimethylmorpholin-4-yl)-2-(2-methoxyethylamino)ethanone.
| Compound Name | 1-(2,2-dimethylmorpholin-4-yl)-2-(2-methoxyethylamino)ethanone |
|---|---|
| PubChem CID | 79282191 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | 1-(2,2-dimethylmorpholin-4-yl)-2-(2-methoxyethylamino)ethanone |
| SMILES | COCCNCC(=O)N1CCOC(C)(C)C1 |
| InChI | InChI=1S/C11H22N2O3/c1-11(2)9-13(5-7-16-11)10(14)8-12-4-6-15-3/h12H,4-9H2,1-3H3 |
| InChIKey | RBMJQTGAYFCCTQ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|