C11H23ClN2O2 — CID 119732360
1-(2,2-dimethylmorpholin-4-yl)-4-(methylamino)butan-1-one;hydrochloride (PubChem CID 119732360) has the molecular formula C11H23ClN2O2 and a molecular weight of 250.77 g/mol. Its IUPAC name is 1-(2,2-dimethylmorpholin-4-yl)-4-(methylamino)butan-1-one;hydrochloride.
| Compound Name | 1-(2,2-dimethylmorpholin-4-yl)-4-(methylamino)butan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119732360 |
| Molecular Formula | C11H23ClN2O2 |
| Molecular Weight | 250.77 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 1-(2,2-dimethylmorpholin-4-yl)-4-(methylamino)butan-1-one;hydrochloride |
| SMILES | CNCCCC(=O)N1CCOC(C)(C)C1.Cl |
| InChI | InChI=1S/C11H22N2O2.ClH/c1-11(2)9-13(7-8-15-11)10(14)5-4-6-12-3;/h12H,4-9H2,1-3H3;1H |
| InChIKey | UHORSCHTSAPWKS-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.77 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|