About 1-(3,5-dimethylpiperidin-1-yl)-4-(methylamino)butan-1-one;hydrochloride
1-(3,5-dimethylpiperidin-1-yl)-4-(methylamino)butan-1-one;hydrochloride (PubChem CID 119671954) has the molecular formula C12H25ClN2O
and a molecular weight of 248.80 g/mol. Its IUPAC name is 1-(3,5-dimethylpiperidin-1-yl)-4-(methylamino)butan-1-one;hydrochloride.
Molecular Properties
| Compound Name | 1-(3,5-dimethylpiperidin-1-yl)-4-(methylamino)butan-1-one;hydrochloride |
| PubChem CID | 119671954 |
| Molecular Formula | C12H25ClN2O |
| Molecular Weight | 248.80 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | 1-(3,5-dimethylpiperidin-1-yl)-4-(methylamino)butan-1-one;hydrochloride |
| SMILES | CNCCCC(=O)N1CC(C)CC(C)C1.Cl |
| InChI | InChI=1S/C12H24N2O.ClH/c1-10-7-11(2)9-14(8-10)12(15)5-4-6-13-3;/h10-11,13H,4-9H2,1-3H3;1H |
| InChIKey | JMNVGVCGNJZYCR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.80 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,5-dimethylpiperidin-1-yl)-4-(methylamino)butan-1-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-dimethylpiperidin-1-yl)-4-(methylamino)butan-1-one;hydrochloride?
The IUPAC name of 1-(3,5-dimethylpiperidin-1-yl)-4-(methylamino)butan-1-one;hydrochloride (CID 119671954) is 1-(3,5-dimethylpiperidin-1-yl)-4-(methylamino)butan-1-one;hydrochloride.
What is the SMILES notation for 1-(3,5-dimethylpiperidin-1-yl)-4-(methylamino)butan-1-one;hydrochloride?
The canonical SMILES for 1-(3,5-dimethylpiperidin-1-yl)-4-(methylamino)butan-1-one;hydrochloride is CNCCCC(=O)N1CC(C)CC(C)C1.Cl.
What is the InChIKey of 1-(3,5-dimethylpiperidin-1-yl)-4-(methylamino)butan-1-one;hydrochloride?
The InChIKey is JMNVGVCGNJZYCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O.ClH/c1-10-7-11(2)9-14(8-10)12(15)5-4-6-13-3;/h10-11,13H,4-9H2,1-3H3;1H.
What are the key properties of 1-(3,5-dimethylpiperidin-1-yl)-4-(methylamino)butan-1-one;hydrochloride?
1-(3,5-dimethylpiperidin-1-yl)-4-(methylamino)butan-1-one;hydrochloride has a molecular weight of 248.80 g/mol, XLogP of 1.91, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-dimethylpiperidin-1-yl)-4-(methylamino)butan-1-one;hydrochloride is sourced from PubChem (CID 119671954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).