C16H35Cl2N3O — CID 119863420
N-[2-(3,5-dimethylpiperidin-1-yl)-2-methylpropyl]-4-(methylamino)butanamide;dihydrochloride (PubChem CID 119863420) has the molecular formula C16H35Cl2N3O and a molecular weight of 356.38 g/mol. Its IUPAC name is N-[2-(3,5-dimethylpiperidin-1-yl)-2-methylpropyl]-4-(methylamino)butanamide;dihydrochloride.
| Compound Name | N-[2-(3,5-dimethylpiperidin-1-yl)-2-methylpropyl]-4-(methylamino)butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119863420 |
| Molecular Formula | C16H35Cl2N3O |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 355.22 |
| IUPAC Name | N-[2-(3,5-dimethylpiperidin-1-yl)-2-methylpropyl]-4-(methylamino)butanamide;dihydrochloride |
| SMILES | CNCCCC(=O)NCC(C)(C)N1CC(C)CC(C)C1.Cl.Cl |
| InChI | InChI=1S/C16H33N3O.2ClH/c1-13-9-14(2)11-19(10-13)16(3,4)12-18-15(20)7-6-8-17-5;;/h13-14,17H,6-12H2,1-5H3,(H,18,20);2*1H |
| InChIKey | YDDQFOFVPLRRLG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|