C11H19NO2 — CID 26026135
1-[(3R,5S)-3,5-dimethylpiperidin-1-yl]butane-1,3-dione (PubChem CID 26026135) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 1-[(3R,5S)-3,5-dimethylpiperidin-1-yl]butane-1,3-dione.
| Compound Name | 1-[(3R,5S)-3,5-dimethylpiperidin-1-yl]butane-1,3-dione |
|---|---|
| PubChem CID | 26026135 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 1-[(3R,5S)-3,5-dimethylpiperidin-1-yl]butane-1,3-dione |
| SMILES | CC(=O)CC(=O)N1C[C@H](C)C[C@H](C)C1 |
| InChI | InChI=1S/C11H19NO2/c1-8-4-9(2)7-12(6-8)11(14)5-10(3)13/h8-9H,4-7H2,1-3H3/t8-,9+ |
| InChIKey | HKSYMUJLTWSBLT-DTORHVGOSA-N |
| XLogP | 1.47 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|