C9H18N2O — CID 24697792
2-amino-1-(3,5-dimethylpiperidin-1-yl)ethanone (PubChem CID 24697792) has the molecular formula C9H18N2O and a molecular weight of 170.26 g/mol. Its IUPAC name is 2-amino-1-(3,5-dimethylpiperidin-1-yl)ethanone.
| Compound Name | 2-amino-1-(3,5-dimethylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 24697792 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | 2-amino-1-(3,5-dimethylpiperidin-1-yl)ethanone |
| SMILES | CC1CC(C)CN(C(=O)CN)C1 |
| InChI | InChI=1S/C9H18N2O/c1-7-3-8(2)6-11(5-7)9(12)4-10/h7-8H,3-6,10H2,1-2H3 |
| InChIKey | HXDDYMWEWOFXKX-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |