C10H18ClNO — CID 40560802
3-chloro-1-[(3R,5S)-3,5-dimethylpiperidin-1-yl]propan-1-one (PubChem CID 40560802) has the molecular formula C10H18ClNO and a molecular weight of 203.71 g/mol. Its IUPAC name is 3-chloro-1-[(3R,5S)-3,5-dimethylpiperidin-1-yl]propan-1-one.
| Compound Name | 3-chloro-1-[(3R,5S)-3,5-dimethylpiperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 40560802 |
| Molecular Formula | C10H18ClNO |
| Molecular Weight | 203.71 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 3-chloro-1-[(3R,5S)-3,5-dimethylpiperidin-1-yl]propan-1-one |
| SMILES | C[C@@H]1C[C@H](C)CN(C(=O)CCCl)C1 |
| InChI | InChI=1S/C10H18ClNO/c1-8-5-9(2)7-12(6-8)10(13)3-4-11/h8-9H,3-7H2,1-2H3/t8-,9+ |
| InChIKey | LNSIPBCCURESMW-DTORHVGOSA-N |
| XLogP | 2.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.71 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|