C9H16ClNO — CID 79183317
3-chloro-1-(3,4-dimethylpyrrolidin-1-yl)propan-1-one (PubChem CID 79183317) has the molecular formula C9H16ClNO and a molecular weight of 189.69 g/mol. Its IUPAC name is 3-chloro-1-(3,4-dimethylpyrrolidin-1-yl)propan-1-one.
| Compound Name | 3-chloro-1-(3,4-dimethylpyrrolidin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 79183317 |
| Molecular Formula | C9H16ClNO |
| Molecular Weight | 189.69 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 3-chloro-1-(3,4-dimethylpyrrolidin-1-yl)propan-1-one |
| SMILES | CC1CN(C(=O)CCCl)CC1C |
| InChI | InChI=1S/C9H16ClNO/c1-7-5-11(6-8(7)2)9(12)3-4-10/h7-8H,3-6H2,1-2H3 |
| InChIKey | SYVOJZXLQSCDBU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.69 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|